C10H18N4O3 — CID 110748123
1-tert-butyl-3-[2-(2,5-dioxoimidazolidin-4-yl)ethyl]urea (PubChem CID 110748123) has the molecular formula C10H18N4O3 and a molecular weight of 242.28 g/mol. Its IUPAC name is 1-tert-butyl-3-[2-(2,5-dioxoimidazolidin-4-yl)ethyl]urea.
| Compound Name | 1-tert-butyl-3-[2-(2,5-dioxoimidazolidin-4-yl)ethyl]urea |
|---|---|
| PubChem CID | 110748123 |
| Molecular Formula | C10H18N4O3 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 1-tert-butyl-3-[2-(2,5-dioxoimidazolidin-4-yl)ethyl]urea |
| SMILES | CC(C)(C)NC(=O)NCCC1NC(=O)NC1=O |
| InChI | InChI=1S/C10H18N4O3/c1-10(2,3)14-8(16)11-5-4-6-7(15)13-9(17)12-6/h6H,4-5H2,1-3H3,(H2,11,14,16)(H2,12,13,15,17) |
| InChIKey | MFWMELIXUOOTAI-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|