C22H20O4 — CID 11078562
1,5-dihydroxy-2-(2-methylprop-1-enyl)-6-(2-methylprop-2-enyl)anthracene-9,10-dione (PubChem CID 11078562) has the molecular formula C22H20O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is 1,5-dihydroxy-2-(2-methylprop-1-enyl)-6-(2-methylprop-2-enyl)anthracene-9,10-dione.
| Compound Name | 1,5-dihydroxy-2-(2-methylprop-1-enyl)-6-(2-methylprop-2-enyl)anthracene-9,10-dione |
|---|---|
| PubChem CID | 11078562 |
| Molecular Formula | C22H20O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 1,5-dihydroxy-2-(2-methylprop-1-enyl)-6-(2-methylprop-2-enyl)anthracene-9,10-dione |
| SMILES | C=C(C)Cc1ccc2c(c1O)C(=O)c1ccc(C=C(C)C)c(O)c1C2=O |
| InChI | InChI=1S/C22H20O4/c1-11(2)9-13-5-7-15-17(19(13)23)21(25)16-8-6-14(10-12(3)4)20(24)18(16)22(15)26/h5-8,10,23-24H,1,9H2,2-4H3 |
| InChIKey | RBGLHHLNXSYEGF-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|