C15H15N3O5S — CID 11078594
2-[(2,4-dioxo-5H-pyrimido[4,5-b][1,4]benzothiazin-1-yl)methoxy]ethyl acetate (PubChem CID 11078594) has the molecular formula C15H15N3O5S and a molecular weight of 349.37 g/mol. Its IUPAC name is 2-[(2,4-dioxo-5H-pyrimido[4,5-b][1,4]benzothiazin-1-yl)methoxy]ethyl acetate.
| Compound Name | 2-[(2,4-dioxo-5H-pyrimido[4,5-b][1,4]benzothiazin-1-yl)methoxy]ethyl acetate |
|---|---|
| PubChem CID | 11078594 |
| Molecular Formula | C15H15N3O5S |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 2-[(2,4-dioxo-5H-pyrimido[4,5-b][1,4]benzothiazin-1-yl)methoxy]ethyl acetate |
| SMILES | CC(=O)OCCOCn1c2c(c(=O)[nH]c1=O)Nc1ccccc1S2 |
| InChI | InChI=1S/C15H15N3O5S/c1-9(19)23-7-6-22-8-18-14-12(13(20)17-15(18)21)16-10-4-2-3-5-11(10)24-14/h2-5,16H,6-8H2,1H3,(H,17,20,21) |
| InChIKey | DCMCUYLVWOKCJZ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|