C25H34O5 — CID 11080185
[(8S,9R,10S,13S,14S,16S,17R)-17-ethynyl-17-hydroxy-3-methoxy-10,13,16-trimethyl-2,7,8,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-9-yl] methyl carbonate (PubChem CID 11080185) has the molecular formula C25H34O5 and a molecular weight of 414.54 g/mol. Its IUPAC name is [(8S,9R,10S,13S,14S,16S,17R)-17-ethynyl-17-hydroxy-3-methoxy-10,13,16-trimethyl-2,7,8,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-9-yl] methyl carbonate.
| Compound Name | [(8S,9R,10S,13S,14S,16S,17R)-17-ethynyl-17-hydroxy-3-methoxy-10,13,16-trimethyl-2,7,8,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-9-yl] methyl carbonate |
|---|---|
| PubChem CID | 11080185 |
| Molecular Formula | C25H34O5 |
| Molecular Weight | 414.54 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | [(8S,9R,10S,13S,14S,16S,17R)-17-ethynyl-17-hydroxy-3-methoxy-10,13,16-trimethyl-2,7,8,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-9-yl] methyl carbonate |
| SMILES | C#C[C@]1(O)[C@@H](C)C[C@H]2[C@@H]3CC=C4C=C(OC)CC[C@]4(C)[C@@]3(OC(=O)OC)CC[C@@]21C |
| InChI | InChI=1S/C25H34O5/c1-7-24(27)16(2)14-20-19-9-8-17-15-18(28-5)10-11-22(17,3)25(19,30-21(26)29-6)13-12-23(20,24)4/h1,8,15-16,19-20,27H,9-14H2,2-6H3/t16-,19-,20-,22-,23-,24-,25+/m0/s1 |
| InChIKey | QBQVJUZZVNWELJ-SJIZZCBNSA-N |
| XLogP | 4.61 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.54 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|