C14H23BO6 — CID 11109281
dipropan-2-yl (4S,5S)-2-[(Z)-but-2-enyl]-1,3,2-dioxaborolane-4,5-dicarboxylate (PubChem CID 11109281) has the molecular formula C14H23BO6 and a molecular weight of 298.14 g/mol. Its IUPAC name is dipropan-2-yl (4S,5S)-2-[(Z)-but-2-enyl]-1,3,2-dioxaborolane-4,5-dicarboxylate.
| Compound Name | dipropan-2-yl (4S,5S)-2-[(Z)-but-2-enyl]-1,3,2-dioxaborolane-4,5-dicarboxylate |
|---|---|
| PubChem CID | 11109281 |
| Molecular Formula | C14H23BO6 |
| Molecular Weight | 298.14 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | dipropan-2-yl (4S,5S)-2-[(Z)-but-2-enyl]-1,3,2-dioxaborolane-4,5-dicarboxylate |
| SMILES | C/C=C\CB1O[C@H](C(=O)OC(C)C)[C@@H](C(=O)OC(C)C)O1 |
| InChI | InChI=1S/C14H23BO6/c1-6-7-8-15-20-11(13(16)18-9(2)3)12(21-15)14(17)19-10(4)5/h6-7,9-12H,8H2,1-5H3/b7-6-/t11-,12-/m0/s1 |
| InChIKey | UQRUTCGBDPMECL-MVSYMCDOSA-N |
| XLogP | 1.74 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.14 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|