C20H24N2O4 — CID 11111068
benzylazanium;(2E,4E)-hexa-2,4-dienedioate (PubChem CID 11111068) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is benzylazanium;(2E,4E)-hexa-2,4-dienedioate.
| Compound Name | benzylazanium;(2E,4E)-hexa-2,4-dienedioate |
|---|---|
| PubChem CID | 11111068 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | benzylazanium;(2E,4E)-hexa-2,4-dienedioate |
| SMILES | O=C([O-])/C=C/C=C/C(=O)[O-].[NH3+]Cc1ccccc1.[NH3+]Cc1ccccc1 |
| InChI | InChI=1S/2C7H9N.C6H6O4/c2*8-6-7-4-2-1-3-5-7;7-5(8)3-1-2-4-6(9)10/h2*1-5H,6,8H2;1-4H,(H,7,8)(H,9,10)/b;;3-1+,4-2+ |
| InChIKey | NSGYRAKUQXSURP-MBLDIUTQSA-N |
| XLogP | -1.54 |
| TPSA | 135.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|