C28H36O3 — CID 11112606
[(1S,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] (1R,2S,4R,5S,7R,9S)-3-hydroxy-3-phenyltetracyclo[5.3.1.02,5.04,9]undecane-2-carboxylate (PubChem CID 11112606) has the molecular formula C28H36O3 and a molecular weight of 420.59 g/mol. Its IUPAC name is [(1S,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] (1R,2S,4R,5S,7R,9S)-3-hydroxy-3-phenyltetracyclo[5.3.1.02,5.04,9]undecane-2-carboxylate.
| Compound Name | [(1S,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] (1R,2S,4R,5S,7R,9S)-3-hydroxy-3-phenyltetracyclo[5.3.1.02,5.04,9]undecane-2-carboxylate |
|---|---|
| PubChem CID | 11112606 |
| Molecular Formula | C28H36O3 |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | [(1S,2S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl] (1R,2S,4R,5S,7R,9S)-3-hydroxy-3-phenyltetracyclo[5.3.1.02,5.04,9]undecane-2-carboxylate |
| SMILES | C[C@@H]1[C@@H](OC(=O)[C@@]23[C@@H]4C[C@H]5C[C@@H](C4)[C@H]([C@@H]2C5)C3(O)c2ccccc2)C[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C28H36O3/c1-15-21-13-19(26(21,2)3)14-23(15)31-25(29)27-20-10-16-9-17(12-20)24(22(27)11-16)28(27,30)18-7-5-4-6-8-18/h4-8,15-17,19-24,30H,9-14H2,1-3H3/t15-,16+,17-,19+,20+,21-,22-,23-,24+,27+,28?/m0/s1 |
| InChIKey | YEGNMMWTJSOFGV-AYZKLWBRSA-N |
| XLogP | 5.17 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |