C32H40O4SSi — CID 11114333
[4-[(Z)-2-(benzenesulfonyl)ethenoxy]-6,6-diphenylhex-5-enoxy]-tert-butyl-dimethylsilane (PubChem CID 11114333) has the molecular formula C32H40O4SSi and a molecular weight of 548.82 g/mol. Its IUPAC name is [4-[(Z)-2-(benzenesulfonyl)ethenoxy]-6,6-diphenylhex-5-enoxy]-tert-butyl-dimethylsilane.
| Compound Name | [4-[(Z)-2-(benzenesulfonyl)ethenoxy]-6,6-diphenylhex-5-enoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11114333 |
| Molecular Formula | C32H40O4SSi |
| Molecular Weight | 548.82 g/mol |
| Exact Mass | 548.24 |
| IUPAC Name | [4-[(Z)-2-(benzenesulfonyl)ethenoxy]-6,6-diphenylhex-5-enoxy]-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCCCC(C=C(c1ccccc1)c1ccccc1)O/C=C\S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C32H40O4SSi/c1-32(2,3)38(4,5)36-23-15-20-29(35-24-25-37(33,34)30-21-13-8-14-22-30)26-31(27-16-9-6-10-17-27)28-18-11-7-12-19-28/h6-14,16-19,21-22,24-26,29H,15,20,23H2,1-5H3/b25-24- |
| InChIKey | BRPGEXLVWHVAFB-IZHYLOQSSA-N |
| XLogP | 8.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.82 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|