C22H35NO4Si — CID 11133250
3-[(4R,5R,8R)-4-[tert-butyl(dimethyl)silyl]oxy-7-oxa-1-azabicyclo[3.2.1]octan-8-yl]propyl benzoate (PubChem CID 11133250) has the molecular formula C22H35NO4Si and a molecular weight of 405.61 g/mol. Its IUPAC name is 3-[(4R,5R,8R)-4-[tert-butyl(dimethyl)silyl]oxy-7-oxa-1-azabicyclo[3.2.1]octan-8-yl]propyl benzoate.
| Compound Name | 3-[(4R,5R,8R)-4-[tert-butyl(dimethyl)silyl]oxy-7-oxa-1-azabicyclo[3.2.1]octan-8-yl]propyl benzoate |
|---|---|
| PubChem CID | 11133250 |
| Molecular Formula | C22H35NO4Si |
| Molecular Weight | 405.61 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | 3-[(4R,5R,8R)-4-[tert-butyl(dimethyl)silyl]oxy-7-oxa-1-azabicyclo[3.2.1]octan-8-yl]propyl benzoate |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CCN2OC[C@H]1[C@H]2CCCOC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H35NO4Si/c1-22(2,3)28(4,5)27-20-13-14-23-19(18(20)16-26-23)12-9-15-25-21(24)17-10-7-6-8-11-17/h6-8,10-11,18-20H,9,12-16H2,1-5H3/t18-,19+,20+/m0/s1 |
| InChIKey | HUHAXRKLNYPRPL-XUVXKRRUSA-N |
| XLogP | 4.65 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.61 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|