C7H14OSi — CID 11137270
(1R,6R)-3,3-dimethyl-7-oxa-3-silabicyclo[4.1.0]heptane (PubChem CID 11137270) has the molecular formula C7H14OSi and a molecular weight of 142.27 g/mol. Its IUPAC name is (1R,6R)-3,3-dimethyl-7-oxa-3-silabicyclo[4.1.0]heptane.
| Compound Name | (1R,6R)-3,3-dimethyl-7-oxa-3-silabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 11137270 |
| Molecular Formula | C7H14OSi |
| Molecular Weight | 142.27 g/mol |
| Exact Mass | 142.08 |
| IUPAC Name | (1R,6R)-3,3-dimethyl-7-oxa-3-silabicyclo[4.1.0]heptane |
| SMILES | C[Si]1(C)CC[C@H]2O[C@H]2C1 |
| InChI | InChI=1S/C7H14OSi/c1-9(2)4-3-6-7(5-9)8-6/h6-7H,3-5H2,1-2H3/t6-,7+/m1/s1 |
| InChIKey | UCFPGMSJYOIBJQ-RQJHMYQMSA-N |
| XLogP | 1.87 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.27 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|