C6H13ClSi — CID 122714183
3-chloro-1,1-dimethylsilolane (PubChem CID 122714183) has the molecular formula C6H13ClSi and a molecular weight of 148.71 g/mol. Its IUPAC name is 3-chloro-1,1-dimethylsilolane.
| Compound Name | 3-chloro-1,1-dimethylsilolane |
|---|---|
| PubChem CID | 122714183 |
| Molecular Formula | C6H13ClSi |
| Molecular Weight | 148.71 g/mol |
| Exact Mass | 148.05 |
| IUPAC Name | 3-chloro-1,1-dimethylsilolane |
| SMILES | C[Si]1(C)CCC(Cl)C1 |
| InChI | InChI=1S/C6H13ClSi/c1-8(2)4-3-6(7)5-8/h6H,3-5H2,1-2H3 |
| InChIKey | GJHGJSWZAQWZNR-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.71 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|