C9H22O2Si2 — CID 71354080
dimethoxymethyl-(1,1-dimethylsilolan-3-yl)silane (PubChem CID 71354080) has the molecular formula C9H22O2Si2 and a molecular weight of 218.44 g/mol. Its IUPAC name is dimethoxymethyl-(1,1-dimethylsilolan-3-yl)silane.
| Compound Name | dimethoxymethyl-(1,1-dimethylsilolan-3-yl)silane |
|---|---|
| PubChem CID | 71354080 |
| Molecular Formula | C9H22O2Si2 |
| Molecular Weight | 218.44 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | dimethoxymethyl-(1,1-dimethylsilolan-3-yl)silane |
| SMILES | COC(OC)[SiH2]C1CC[Si](C)(C)C1 |
| InChI | InChI=1S/C9H22O2Si2/c1-10-9(11-2)12-8-5-6-13(3,4)7-8/h8-9H,5-7,12H2,1-4H3 |
| InChIKey | NVLCEQMFUSGTSI-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.44 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|