About 3-iodo-1,1-dimethylsilolane
3-iodo-1,1-dimethylsilolane (PubChem CID 122714210) has the molecular formula C6H13ISi
and a molecular weight of 240.16 g/mol. Its IUPAC name is 3-iodo-1,1-dimethylsilolane.
Molecular Properties
| Compound Name | 3-iodo-1,1-dimethylsilolane |
| PubChem CID | 122714210 |
| Molecular Formula | C6H13ISi |
| Molecular Weight | 240.16 g/mol |
| Exact Mass | 239.98 |
| IUPAC Name | 3-iodo-1,1-dimethylsilolane |
| SMILES | C[Si]1(C)CCC(I)C1 |
| InChI | InChI=1S/C6H13ISi/c1-8(2)4-3-6(7)5-8/h6H,3-5H2,1-2H3 |
| InChIKey | CYCASAFEKWNECR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.16 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-1,1-dimethylsilolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-1,1-dimethylsilolane?
The IUPAC name of 3-iodo-1,1-dimethylsilolane (CID 122714210) is 3-iodo-1,1-dimethylsilolane.
What is the SMILES notation for 3-iodo-1,1-dimethylsilolane?
The canonical SMILES for 3-iodo-1,1-dimethylsilolane is C[Si]1(C)CCC(I)C1.
What is the InChIKey of 3-iodo-1,1-dimethylsilolane?
The InChIKey is CYCASAFEKWNECR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13ISi/c1-8(2)4-3-6(7)5-8/h6H,3-5H2,1-2H3.
What are the key properties of 3-iodo-1,1-dimethylsilolane?
3-iodo-1,1-dimethylsilolane has a molecular weight of 240.16 g/mol, XLogP of 2.90, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-1,1-dimethylsilolane is sourced from PubChem (CID 122714210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).