C19H16O4 — CID 11141353
(4S,5S)-4-(2-phenylethynyl)-5-(phenylmethoxymethyl)-1,3-dioxolan-2-one (PubChem CID 11141353) has the molecular formula C19H16O4 and a molecular weight of 308.33 g/mol. Its IUPAC name is (4S,5S)-4-(2-phenylethynyl)-5-(phenylmethoxymethyl)-1,3-dioxolan-2-one.
| Compound Name | (4S,5S)-4-(2-phenylethynyl)-5-(phenylmethoxymethyl)-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 11141353 |
| Molecular Formula | C19H16O4 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | (4S,5S)-4-(2-phenylethynyl)-5-(phenylmethoxymethyl)-1,3-dioxolan-2-one |
| SMILES | O=C1O[C@@H](C#Cc2ccccc2)[C@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C19H16O4/c20-19-22-17(12-11-15-7-3-1-4-8-15)18(23-19)14-21-13-16-9-5-2-6-10-16/h1-10,17-18H,13-14H2/t17-,18-/m0/s1 |
| InChIKey | HZKHNVADLJJKAV-ROUUACIJSA-N |
| XLogP | 3.16 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|