C11H15O2 — CID 11141668
CID 11141668 (PubChem CID 11141668) has the molecular formula C11H15O2 and a molecular weight of 179.24 g/mol.
| Compound Name | CID 11141668 |
|---|---|
| PubChem CID | 11141668 |
| Molecular Formula | C11H15O2 |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | — |
| SMILES | CC1(C)COC([C]2[CH][CH][CH][CH]2)OC1 |
| InChI | InChI=1S/C11H15O2/c1-11(2)7-12-10(13-8-11)9-5-3-4-6-9/h3-6,10H,7-8H2,1-2H3 |
| InChIKey | MXCGWMROEGRJCP-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |