C11H17NO2 — CID 10703013
2-(5,5-dimethyl-1,3-dioxan-2-yl)-4-methyl-1H-pyrrole (PubChem CID 10703013) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is 2-(5,5-dimethyl-1,3-dioxan-2-yl)-4-methyl-1H-pyrrole.
| Compound Name | 2-(5,5-dimethyl-1,3-dioxan-2-yl)-4-methyl-1H-pyrrole |
|---|---|
| PubChem CID | 10703013 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 2-(5,5-dimethyl-1,3-dioxan-2-yl)-4-methyl-1H-pyrrole |
| SMILES | Cc1c[nH]c(C2OCC(C)(C)CO2)c1 |
| InChI | InChI=1S/C11H17NO2/c1-8-4-9(12-5-8)10-13-6-11(2,3)7-14-10/h4-5,10,12H,6-7H2,1-3H3 |
| InChIKey | KUAFHHCVTOHCNU-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |