C19H34O4Si — CID 11142782
(1R)-1-[(1S,2S,3R,4R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-oxabicyclo[2.2.1]hept-5-en-2-yl]-1-hydroxyhexan-3-one (PubChem CID 11142782) has the molecular formula C19H34O4Si and a molecular weight of 354.56 g/mol. Its IUPAC name is (1R)-1-[(1S,2S,3R,4R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-oxabicyclo[2.2.1]hept-5-en-2-yl]-1-hydroxyhexan-3-one.
| Compound Name | (1R)-1-[(1S,2S,3R,4R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-oxabicyclo[2.2.1]hept-5-en-2-yl]-1-hydroxyhexan-3-one |
|---|---|
| PubChem CID | 11142782 |
| Molecular Formula | C19H34O4Si |
| Molecular Weight | 354.56 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | (1R)-1-[(1S,2S,3R,4R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-7-oxabicyclo[2.2.1]hept-5-en-2-yl]-1-hydroxyhexan-3-one |
| SMILES | CCCC(=O)C[C@@H](O)[C@@H]1[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]2C=C[C@@H]1O2 |
| InChI | InChI=1S/C19H34O4Si/c1-7-8-13(20)11-15(21)18-14(16-9-10-17(18)23-16)12-22-24(5,6)19(2,3)4/h9-10,14-18,21H,7-8,11-12H2,1-6H3/t14-,15-,16-,17+,18+/m1/s1 |
| InChIKey | UCZIQYDLLACPQS-DZVNLGKHSA-N |
| XLogP | 3.70 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.56 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|