C20H37NO4Si — CID 10992613
tert-butyl N-[(2R,3S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-prop-2-enyl-3,6-dihydro-2H-pyran-3-yl]carbamate (PubChem CID 10992613) has the molecular formula C20H37NO4Si and a molecular weight of 383.61 g/mol. Its IUPAC name is tert-butyl N-[(2R,3S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-prop-2-enyl-3,6-dihydro-2H-pyran-3-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,3S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-prop-2-enyl-3,6-dihydro-2H-pyran-3-yl]carbamate |
|---|---|
| PubChem CID | 10992613 |
| Molecular Formula | C20H37NO4Si |
| Molecular Weight | 383.61 g/mol |
| Exact Mass | 383.25 |
| IUPAC Name | tert-butyl N-[(2R,3S,6S)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-prop-2-enyl-3,6-dihydro-2H-pyran-3-yl]carbamate |
| SMILES | C=CC[C@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)C=C[C@@H]1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H37NO4Si/c1-10-11-17-16(21-18(22)25-19(2,3)4)13-12-15(24-17)14-23-26(8,9)20(5,6)7/h10,12-13,15-17H,1,11,14H2,2-9H3,(H,21,22)/t15-,16-,17+/m0/s1 |
| InChIKey | TVXVHAHFBUAWJH-YESZJQIVSA-N |
| XLogP | 4.80 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.61 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|