C21H34O3Si — CID 11142995
(5aS,6S,9aR,9bR)-4-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-8,9a-dimethyl-2,3,5,5a,6,9b-hexahydro-1H-cyclopenta[a]naphthalen-9-one (PubChem CID 11142995) has the molecular formula C21H34O3Si and a molecular weight of 362.59 g/mol. Its IUPAC name is (5aS,6S,9aR,9bR)-4-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-8,9a-dimethyl-2,3,5,5a,6,9b-hexahydro-1H-cyclopenta[a]naphthalen-9-one.
| Compound Name | (5aS,6S,9aR,9bR)-4-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-8,9a-dimethyl-2,3,5,5a,6,9b-hexahydro-1H-cyclopenta[a]naphthalen-9-one |
|---|---|
| PubChem CID | 11142995 |
| Molecular Formula | C21H34O3Si |
| Molecular Weight | 362.59 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | (5aS,6S,9aR,9bR)-4-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-8,9a-dimethyl-2,3,5,5a,6,9b-hexahydro-1H-cyclopenta[a]naphthalen-9-one |
| SMILES | CC1=C[C@H](O)[C@H]2CC(O[Si](C)(C)C(C)(C)C)=C3CCC[C@H]3[C@@]2(C)C1=O |
| InChI | InChI=1S/C21H34O3Si/c1-13-11-17(22)16-12-18(24-25(6,7)20(2,3)4)14-9-8-10-15(14)21(16,5)19(13)23/h11,15-17,22H,8-10,12H2,1-7H3/t15-,16-,17+,21-/m1/s1 |
| InChIKey | JUPYXNINBRAKMT-PZTGFMGMSA-N |
| XLogP | 4.98 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.59 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|