C17H29NO6S — CID 11153063
tert-butyl N-[(4aR,6R,7S,8R,8aR)-2,2-dimethyl-6-prop-2-enoxy-8-sulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]carbamate (PubChem CID 11153063) has the molecular formula C17H29NO6S and a molecular weight of 375.49 g/mol. Its IUPAC name is tert-butyl N-[(4aR,6R,7S,8R,8aR)-2,2-dimethyl-6-prop-2-enoxy-8-sulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]carbamate.
| Compound Name | tert-butyl N-[(4aR,6R,7S,8R,8aR)-2,2-dimethyl-6-prop-2-enoxy-8-sulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]carbamate |
|---|---|
| PubChem CID | 11153063 |
| Molecular Formula | C17H29NO6S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | tert-butyl N-[(4aR,6R,7S,8R,8aR)-2,2-dimethyl-6-prop-2-enoxy-8-sulfanyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]carbamate |
| SMILES | C=CCO[C@@H]1O[C@@H]2COC(C)(C)O[C@H]2[C@H](S)[C@H]1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H29NO6S/c1-7-8-20-14-11(18-15(19)24-16(2,3)4)13(25)12-10(22-14)9-21-17(5,6)23-12/h7,10-14,25H,1,8-9H2,2-6H3,(H,18,19)/t10-,11-,12-,13-,14-/m1/s1 |
| InChIKey | QIIKDAUGNHANQV-DHGKCCLASA-N |
| XLogP | 2.26 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|