C19H26ClFIN5OS — CID 111569356
N-[2-[[N-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide (PubChem CID 111569356) has the molecular formula C19H26ClFIN5OS and a molecular weight of 553.87 g/mol. Its IUPAC name is N-[2-[[N-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide.
| Compound Name | N-[2-[[N-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111569356 |
| Molecular Formula | C19H26ClFIN5OS |
| Molecular Weight | 553.87 g/mol |
| Exact Mass | 553.06 |
| IUPAC Name | N-[2-[[N-[2-(2-chloro-4-fluorophenyl)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]ethyl]-4-methyl-1,3-thiazole-5-carboxamide;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)c1scnc1C)NCC(C)(C)c1ccc(F)cc1Cl.I |
| InChI | InChI=1S/C19H25ClFN5OS.HI/c1-12-16(28-11-26-12)17(27)23-7-8-24-18(22-4)25-10-19(2,3)14-6-5-13(21)9-15(14)20;/h5-6,9,11H,7-8,10H2,1-4H3,(H,23,27)(H2,22,24,25);1H |
| InChIKey | RGXUWXMWJDWVLV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.87 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|