C8H14NO10P — CID 11174492
[(2R,3R)-3-acetyloxy-4-(hydroxyamino)-4-oxo-1-phosphonooxybutan-2-yl] acetate (PubChem CID 11174492) has the molecular formula C8H14NO10P and a molecular weight of 315.17 g/mol. Its IUPAC name is [(2R,3R)-3-acetyloxy-4-(hydroxyamino)-4-oxo-1-phosphonooxybutan-2-yl] acetate.
| Compound Name | [(2R,3R)-3-acetyloxy-4-(hydroxyamino)-4-oxo-1-phosphonooxybutan-2-yl] acetate |
|---|---|
| PubChem CID | 11174492 |
| Molecular Formula | C8H14NO10P |
| Molecular Weight | 315.17 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | [(2R,3R)-3-acetyloxy-4-(hydroxyamino)-4-oxo-1-phosphonooxybutan-2-yl] acetate |
| SMILES | CC(=O)O[C@H](COP(=O)(O)O)[C@@H](OC(C)=O)C(=O)NO |
| InChI | InChI=1S/C8H14NO10P/c1-4(10)18-6(3-17-20(14,15)16)7(8(12)9-13)19-5(2)11/h6-7,13H,3H2,1-2H3,(H,9,12)(H2,14,15,16)/t6-,7-/m1/s1 |
| InChIKey | KQWSEXYWBMLBQI-RNFRBKRXSA-N |
| XLogP | -1.54 |
| TPSA | 168.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.17 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|