C19H24Cl2IN3O3 — CID 111801171
1-[1-(2,4-dichlorophenyl)ethyl]-2-[2-(3,5-dimethoxyphenyl)-2-hydroxyethyl]guanidine;hydroiodide (PubChem CID 111801171) has the molecular formula C19H24Cl2IN3O3 and a molecular weight of 540.23 g/mol. Its IUPAC name is 1-[1-(2,4-dichlorophenyl)ethyl]-2-[2-(3,5-dimethoxyphenyl)-2-hydroxyethyl]guanidine;hydroiodide.
| Compound Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[2-(3,5-dimethoxyphenyl)-2-hydroxyethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111801171 |
| Molecular Formula | C19H24Cl2IN3O3 |
| Molecular Weight | 540.23 g/mol |
| Exact Mass | 539.02 |
| IUPAC Name | 1-[1-(2,4-dichlorophenyl)ethyl]-2-[2-(3,5-dimethoxyphenyl)-2-hydroxyethyl]guanidine;hydroiodide |
| SMILES | COc1cc(OC)cc(C(O)C/N=C(\N)NC(C)c2ccc(Cl)cc2Cl)c1.I |
| InChI | InChI=1S/C19H23Cl2N3O3.HI/c1-11(16-5-4-13(20)8-17(16)21)24-19(22)23-10-18(25)12-6-14(26-2)9-15(7-12)27-3;/h4-9,11,18,25H,10H2,1-3H3,(H3,22,23,24);1H |
| InChIKey | IETCWJPGPJPMBK-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.23 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|