C15H25BrIN3S — CID 111821435
2-[2-(4-bromophenyl)sulfanyl-2-methylpropyl]-1,1-diethylguanidine;hydroiodide (PubChem CID 111821435) has the molecular formula C15H25BrIN3S and a molecular weight of 486.26 g/mol. Its IUPAC name is 2-[2-(4-bromophenyl)sulfanyl-2-methylpropyl]-1,1-diethylguanidine;hydroiodide.
| Compound Name | 2-[2-(4-bromophenyl)sulfanyl-2-methylpropyl]-1,1-diethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111821435 |
| Molecular Formula | C15H25BrIN3S |
| Molecular Weight | 486.26 g/mol |
| Exact Mass | 485.00 |
| IUPAC Name | 2-[2-(4-bromophenyl)sulfanyl-2-methylpropyl]-1,1-diethylguanidine;hydroiodide |
| SMILES | CCN(CC)/C(N)=N/CC(C)(C)Sc1ccc(Br)cc1.I |
| InChI | InChI=1S/C15H24BrN3S.HI/c1-5-19(6-2)14(17)18-11-15(3,4)20-13-9-7-12(16)8-10-13;/h7-10H,5-6,11H2,1-4H3,(H2,17,18);1H |
| InChIKey | FBCOXEFSFCIKIM-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.26 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|