C11H13ClN4S — CID 11184756
8-chloro-5-methylsulfanyl-2,4,6,7-tetrazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraene (PubChem CID 11184756) has the molecular formula C11H13ClN4S and a molecular weight of 268.77 g/mol. Its IUPAC name is 8-chloro-5-methylsulfanyl-2,4,6,7-tetrazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraene.
| Compound Name | 8-chloro-5-methylsulfanyl-2,4,6,7-tetrazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraene |
|---|---|
| PubChem CID | 11184756 |
| Molecular Formula | C11H13ClN4S |
| Molecular Weight | 268.77 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 8-chloro-5-methylsulfanyl-2,4,6,7-tetrazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraene |
| SMILES | CSc1nc2nc3c(c(Cl)n2n1)CCCCC3 |
| InChI | InChI=1S/C11H13ClN4S/c1-17-11-14-10-13-8-6-4-2-3-5-7(8)9(12)16(10)15-11/h2-6H2,1H3 |
| InChIKey | AHAPQYBDBARNLA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.77 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |