C19H28F3IN6 — CID 111915120
1-ethyl-2-[2-(2-methylbenzimidazol-1-yl)ethyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide (PubChem CID 111915120) has the molecular formula C19H28F3IN6 and a molecular weight of 524.37 g/mol. Its IUPAC name is 1-ethyl-2-[2-(2-methylbenzimidazol-1-yl)ethyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-(2-methylbenzimidazol-1-yl)ethyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111915120 |
| Molecular Formula | C19H28F3IN6 |
| Molecular Weight | 524.37 g/mol |
| Exact Mass | 524.14 |
| IUPAC Name | 1-ethyl-2-[2-(2-methylbenzimidazol-1-yl)ethyl]-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCn1c(C)nc2ccccc21)NC1CCN(CC(F)(F)F)C1.I |
| InChI | InChI=1S/C19H27F3N6.HI/c1-3-23-18(26-15-8-10-27(12-15)13-19(20,21)22)24-9-11-28-14(2)25-16-6-4-5-7-17(16)28;/h4-7,15H,3,8-13H2,1-2H3,(H2,23,24,26);1H |
| InChIKey | KZRPQEGOXDDORQ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|