C37H68O4Si2 — CID 11192978
(2Z,4R,6Z,8E,12E,15S,16E,18Z)-20-[tert-butyl(dimethyl)silyl]oxy-18-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-methoxy-3,15-dimethylicosa-2,6,8,12,16,18-hexaen-1-ol (PubChem CID 11192978) has the molecular formula C37H68O4Si2 and a molecular weight of 633.12 g/mol. Its IUPAC name is (2Z,4R,6Z,8E,12E,15S,16E,18Z)-20-[tert-butyl(dimethyl)silyl]oxy-18-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-methoxy-3,15-dimethylicosa-2,6,8,12,16,18-hexaen-1-ol.
| Compound Name | (2Z,4R,6Z,8E,12E,15S,16E,18Z)-20-[tert-butyl(dimethyl)silyl]oxy-18-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-methoxy-3,15-dimethylicosa-2,6,8,12,16,18-hexaen-1-ol |
|---|---|
| PubChem CID | 11192978 |
| Molecular Formula | C37H68O4Si2 |
| Molecular Weight | 633.12 g/mol |
| Exact Mass | 632.47 |
| IUPAC Name | (2Z,4R,6Z,8E,12E,15S,16E,18Z)-20-[tert-butyl(dimethyl)silyl]oxy-18-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-methoxy-3,15-dimethylicosa-2,6,8,12,16,18-hexaen-1-ol |
| SMILES | CO[C@H](C/C=C\C=C\CC/C=C/C[C@H](C)/C=C/C(=C\CO[Si](C)(C)C(C)(C)C)CCO[Si](C)(C)C(C)(C)C)/C(C)=C\CO |
| InChI | InChI=1S/C37H68O4Si2/c1-32(22-20-18-16-14-15-17-19-21-23-35(39-9)33(2)26-29-38)24-25-34(27-30-40-42(10,11)36(3,4)5)28-31-41-43(12,13)37(6,7)8/h15,17-21,24-27,32,35,38H,14,16,22-23,28-31H2,1-13H3/b17-15+,20-18+,21-19-,25-24+,33-26-,34-27+/t32-,35+/m0/s1 |
| InChIKey | TVZAPPNAZOENIF-IBHIOJJQSA-N |
| XLogP | 10.72 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.12 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|