C21H42O2Si2 — CID 134887288
(4E,6R,7S,8E)-7-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-9-trimethylsilylnona-1,4,8-trien-3-ol (PubChem CID 134887288) has the molecular formula C21H42O2Si2 and a molecular weight of 382.74 g/mol. Its IUPAC name is (4E,6R,7S,8E)-7-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-9-trimethylsilylnona-1,4,8-trien-3-ol.
| Compound Name | (4E,6R,7S,8E)-7-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-9-trimethylsilylnona-1,4,8-trien-3-ol |
|---|---|
| PubChem CID | 134887288 |
| Molecular Formula | C21H42O2Si2 |
| Molecular Weight | 382.74 g/mol |
| Exact Mass | 382.27 |
| IUPAC Name | (4E,6R,7S,8E)-7-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethyl-9-trimethylsilylnona-1,4,8-trien-3-ol |
| SMILES | C=C(C)C(O)/C(C)=C/[C@@H](C)[C@@H](/C=C/[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H42O2Si2/c1-16(2)20(22)18(4)15-17(3)19(13-14-24(8,9)10)23-25(11,12)21(5,6)7/h13-15,17,19-20,22H,1H2,2-12H3/b14-13+,18-15+/t17-,19-,20?/m1/s1 |
| InChIKey | QSLJPLYWUZGIRT-UEMMGTENSA-N |
| XLogP | 6.33 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.74 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|