C18H36O2Si — CID 138970955
(2E,4E,6R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-3,4,6-trimethylnona-2,4-dien-1-ol (PubChem CID 138970955) has the molecular formula C18H36O2Si and a molecular weight of 312.57 g/mol. Its IUPAC name is (2E,4E,6R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-3,4,6-trimethylnona-2,4-dien-1-ol.
| Compound Name | (2E,4E,6R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-3,4,6-trimethylnona-2,4-dien-1-ol |
|---|---|
| PubChem CID | 138970955 |
| Molecular Formula | C18H36O2Si |
| Molecular Weight | 312.57 g/mol |
| Exact Mass | 312.25 |
| IUPAC Name | (2E,4E,6R,7S)-7-[tert-butyl(dimethyl)silyl]oxy-3,4,6-trimethylnona-2,4-dien-1-ol |
| SMILES | CC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)/C=C(C)/C(C)=C/CO |
| InChI | InChI=1S/C18H36O2Si/c1-10-17(20-21(8,9)18(5,6)7)16(4)13-15(3)14(2)11-12-19/h11,13,16-17,19H,10,12H2,1-9H3/b14-11+,15-13+/t16-,17+/m1/s1 |
| InChIKey | OAJUTRVUOQXNKB-LHEQYPAXSA-N |
| XLogP | 5.31 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.57 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|