C21H30ClN5O2 — CID 111982071
1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-ethyl-2-[(2-hydroxy-1-methylcyclohexyl)methyl]guanidine (PubChem CID 111982071) has the molecular formula C21H30ClN5O2 and a molecular weight of 419.96 g/mol. Its IUPAC name is 1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-ethyl-2-[(2-hydroxy-1-methylcyclohexyl)methyl]guanidine.
| Compound Name | 1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-ethyl-2-[(2-hydroxy-1-methylcyclohexyl)methyl]guanidine |
|---|---|
| PubChem CID | 111982071 |
| Molecular Formula | C21H30ClN5O2 |
| Molecular Weight | 419.96 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 1-[2-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-ethyl-2-[(2-hydroxy-1-methylcyclohexyl)methyl]guanidine |
| SMILES | CCN/C(=N\CC1(C)CCCCC1O)NCCc1nc(-c2ccc(Cl)cc2)no1 |
| InChI | InChI=1S/C21H30ClN5O2/c1-3-23-20(25-14-21(2)12-5-4-6-17(21)28)24-13-11-18-26-19(27-29-18)15-7-9-16(22)10-8-15/h7-10,17,28H,3-6,11-14H2,1-2H3,(H2,23,24,25) |
| InChIKey | IQDWHSIKNMWATR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 95.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.96 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|