C17H14Cl2N2O2S — CID 11199882
6-chloro-2-[[(E)-2-(4-chloro-3-methylphenyl)ethenyl]sulfonylmethyl]-1H-benzimidazole (PubChem CID 11199882) has the molecular formula C17H14Cl2N2O2S and a molecular weight of 381.28 g/mol. Its IUPAC name is 6-chloro-2-[[(E)-2-(4-chloro-3-methylphenyl)ethenyl]sulfonylmethyl]-1H-benzimidazole.
| Compound Name | 6-chloro-2-[[(E)-2-(4-chloro-3-methylphenyl)ethenyl]sulfonylmethyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 11199882 |
| Molecular Formula | C17H14Cl2N2O2S |
| Molecular Weight | 381.28 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | 6-chloro-2-[[(E)-2-(4-chloro-3-methylphenyl)ethenyl]sulfonylmethyl]-1H-benzimidazole |
| SMILES | Cc1cc(/C=C/S(=O)(=O)Cc2nc3ccc(Cl)cc3[nH]2)ccc1Cl |
| InChI | InChI=1S/C17H14Cl2N2O2S/c1-11-8-12(2-4-14(11)19)6-7-24(22,23)10-17-20-15-5-3-13(18)9-16(15)21-17/h2-9H,10H2,1H3,(H,20,21)/b7-6+ |
| InChIKey | KPOVIPBWBHMRSG-VOTSOKGWSA-N |
| XLogP | 4.76 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.28 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |