C29H30N4O2 — CID 11202155
1-[2-acetyl-5-(9-benzylpurin-6-yl)-6-butyl-1,3-dihydroinden-2-yl]ethanone (PubChem CID 11202155) has the molecular formula C29H30N4O2 and a molecular weight of 466.59 g/mol. Its IUPAC name is 1-[2-acetyl-5-(9-benzylpurin-6-yl)-6-butyl-1,3-dihydroinden-2-yl]ethanone.
| Compound Name | 1-[2-acetyl-5-(9-benzylpurin-6-yl)-6-butyl-1,3-dihydroinden-2-yl]ethanone |
|---|---|
| PubChem CID | 11202155 |
| Molecular Formula | C29H30N4O2 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | 1-[2-acetyl-5-(9-benzylpurin-6-yl)-6-butyl-1,3-dihydroinden-2-yl]ethanone |
| SMILES | CCCCc1cc2c(cc1-c1ncnc3c1ncn3Cc1ccccc1)CC(C(C)=O)(C(C)=O)C2 |
| InChI | InChI=1S/C29H30N4O2/c1-4-5-11-22-12-23-14-29(19(2)34,20(3)35)15-24(23)13-25(22)26-27-28(31-17-30-26)33(18-32-27)16-21-9-7-6-8-10-21/h6-10,12-13,17-18H,4-5,11,14-16H2,1-3H3 |
| InChIKey | YSFOSERVOGPUMF-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|