C25H33N3O5Si — CID 11213860
[(2R,3R,4S,6S)-4-azido-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methoxyoxan-3-yl] acetate (PubChem CID 11213860) has the molecular formula C25H33N3O5Si and a molecular weight of 483.64 g/mol. Its IUPAC name is [(2R,3R,4S,6S)-4-azido-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methoxyoxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,6S)-4-azido-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methoxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 11213860 |
| Molecular Formula | C25H33N3O5Si |
| Molecular Weight | 483.64 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | [(2R,3R,4S,6S)-4-azido-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methoxyoxan-3-yl] acetate |
| SMILES | CO[C@@H]1O[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C[C@H](N=[N+]=[N-])[C@H]1OC(C)=O |
| InChI | InChI=1S/C25H33N3O5Si/c1-18(29)32-23-22(27-28-26)16-19(33-24(23)30-5)17-31-34(25(2,3)4,20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-15,19,22-24H,16-17H2,1-5H3/t19-,22-,23+,24+/m0/s1 |
| InChIKey | YDYQZKWAYXYJNJ-ZMUKGBGYSA-N |
| XLogP | 3.93 |
| TPSA | 102.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.64 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|