C20H20ClF3N6O2 — CID 11225163
2-[3-[[2-(3-chlorophenyl)-2,2-difluoroethyl]amino]-6-cyano-2-fluorophenyl]-N-[2-(diaminomethylideneamino)oxyethyl]acetamide (PubChem CID 11225163) has the molecular formula C20H20ClF3N6O2 and a molecular weight of 468.87 g/mol. Its IUPAC name is 2-[3-[[2-(3-chlorophenyl)-2,2-difluoroethyl]amino]-6-cyano-2-fluorophenyl]-N-[2-(diaminomethylideneamino)oxyethyl]acetamide.
| Compound Name | 2-[3-[[2-(3-chlorophenyl)-2,2-difluoroethyl]amino]-6-cyano-2-fluorophenyl]-N-[2-(diaminomethylideneamino)oxyethyl]acetamide |
|---|---|
| PubChem CID | 11225163 |
| Molecular Formula | C20H20ClF3N6O2 |
| Molecular Weight | 468.87 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | 2-[3-[[2-(3-chlorophenyl)-2,2-difluoroethyl]amino]-6-cyano-2-fluorophenyl]-N-[2-(diaminomethylideneamino)oxyethyl]acetamide |
| SMILES | N#Cc1ccc(NCC(F)(F)c2cccc(Cl)c2)c(F)c1CC(=O)NCCON=C(N)N |
| InChI | InChI=1S/C20H20ClF3N6O2/c21-14-3-1-2-13(8-14)20(23,24)11-29-16-5-4-12(10-25)15(18(16)22)9-17(31)28-6-7-32-30-19(26)27/h1-5,8,29H,6-7,9,11H2,(H,28,31)(H4,26,27,30) |
| InChIKey | GKOBSEMUCNGNJM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 138.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.87 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|