C26H32O3S2Si — CID 11237076
O-[[(1R,2R,3S,4S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-7-oxabicyclo[2.2.1]hept-5-en-2-yl]methyl] methylsulfanylmethanethioate (PubChem CID 11237076) has the molecular formula C26H32O3S2Si and a molecular weight of 484.76 g/mol. Its IUPAC name is O-[[(1R,2R,3S,4S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-7-oxabicyclo[2.2.1]hept-5-en-2-yl]methyl] methylsulfanylmethanethioate.
| Compound Name | O-[[(1R,2R,3S,4S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-7-oxabicyclo[2.2.1]hept-5-en-2-yl]methyl] methylsulfanylmethanethioate |
|---|---|
| PubChem CID | 11237076 |
| Molecular Formula | C26H32O3S2Si |
| Molecular Weight | 484.76 g/mol |
| Exact Mass | 484.16 |
| IUPAC Name | O-[[(1R,2R,3S,4S)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-7-oxabicyclo[2.2.1]hept-5-en-2-yl]methyl] methylsulfanylmethanethioate |
| SMILES | CSC(=S)OC[C@H]1[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H]2C=C[C@H]1O2 |
| InChI | InChI=1S/C26H32O3S2Si/c1-26(2,3)32(19-11-7-5-8-12-19,20-13-9-6-10-14-20)28-18-22-21(17-27-25(30)31-4)23-15-16-24(22)29-23/h5-16,21-24H,17-18H2,1-4H3/t21-,22+,23+,24-/m0/s1 |
| InChIKey | NTBCXEGPFJISGC-KEZOAJOQSA-N |
| XLogP | 4.80 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.76 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|