C27H40O7S2Si — CID 11250022
methyl 6-(benzenesulfonyl)-5-(benzenesulfonylmethyl)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]hexanoate (PubChem CID 11250022) has the molecular formula C27H40O7S2Si and a molecular weight of 568.83 g/mol. Its IUPAC name is methyl 6-(benzenesulfonyl)-5-(benzenesulfonylmethyl)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]hexanoate.
| Compound Name | methyl 6-(benzenesulfonyl)-5-(benzenesulfonylmethyl)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]hexanoate |
|---|---|
| PubChem CID | 11250022 |
| Molecular Formula | C27H40O7S2Si |
| Molecular Weight | 568.83 g/mol |
| Exact Mass | 568.20 |
| IUPAC Name | methyl 6-(benzenesulfonyl)-5-(benzenesulfonylmethyl)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]hexanoate |
| SMILES | COC(=O)CCC(CO[Si](C)(C)C(C)(C)C)C(CS(=O)(=O)c1ccccc1)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C27H40O7S2Si/c1-27(2,3)37(5,6)34-19-22(17-18-26(28)33-4)23(20-35(29,30)24-13-9-7-10-14-24)21-36(31,32)25-15-11-8-12-16-25/h7-16,22-23H,17-21H2,1-6H3 |
| InChIKey | BGRGVPNRKZUOED-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.83 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|