C41H60O6Si — CID 11250959
(1R,3S,5R,7R,9R,13R,15S,18S)-7-[tert-butyl(diphenyl)silyl]oxy-3-methoxy-18-methyl-13-[(E)-4-methylpent-1-enyl]-12,19,20-trioxatricyclo[13.3.1.15,9]icosan-11-one (PubChem CID 11250959) has the molecular formula C41H60O6Si and a molecular weight of 677.01 g/mol. Its IUPAC name is (1R,3S,5R,7R,9R,13R,15S,18S)-7-[tert-butyl(diphenyl)silyl]oxy-3-methoxy-18-methyl-13-[(E)-4-methylpent-1-enyl]-12,19,20-trioxatricyclo[13.3.1.15,9]icosan-11-one.
| Compound Name | (1R,3S,5R,7R,9R,13R,15S,18S)-7-[tert-butyl(diphenyl)silyl]oxy-3-methoxy-18-methyl-13-[(E)-4-methylpent-1-enyl]-12,19,20-trioxatricyclo[13.3.1.15,9]icosan-11-one |
|---|---|
| PubChem CID | 11250959 |
| Molecular Formula | C41H60O6Si |
| Molecular Weight | 677.01 g/mol |
| Exact Mass | 676.42 |
| IUPAC Name | (1R,3S,5R,7R,9R,13R,15S,18S)-7-[tert-butyl(diphenyl)silyl]oxy-3-methoxy-18-methyl-13-[(E)-4-methylpent-1-enyl]-12,19,20-trioxatricyclo[13.3.1.15,9]icosan-11-one |
| SMILES | CO[C@H]1C[C@@H]2C[C@@H](O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C[C@H](CC(=O)O[C@@H](/C=C/CC(C)C)C[C@@H]3CC[C@H](C)[C@@H](C1)O3)O2 |
| InChI | InChI=1S/C41H60O6Si/c1-29(2)15-14-16-31-23-32-22-21-30(3)39(45-32)27-33(43-7)24-34-25-36(26-35(44-34)28-40(42)46-31)47-48(41(4,5)6,37-17-10-8-11-18-37)38-19-12-9-13-20-38/h8-14,16-20,29-36,39H,15,21-28H2,1-7H3/b16-14+/t30-,31-,32-,33-,34+,35+,36+,39+/m0/s1 |
| InChIKey | OEJLKCMEULSULJ-WXVNAONKSA-N |
| XLogP | 7.77 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.01 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|