C19H28N2O7 — CID 11257972
(2,5-dioxopyrrolidin-1-yl) 4-[5-(3,4-dihydro-2H-pyran-2-ylmethoxy)pentylamino]-4-oxobutanoate (PubChem CID 11257972) has the molecular formula C19H28N2O7 and a molecular weight of 396.44 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[5-(3,4-dihydro-2H-pyran-2-ylmethoxy)pentylamino]-4-oxobutanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[5-(3,4-dihydro-2H-pyran-2-ylmethoxy)pentylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 11257972 |
| Molecular Formula | C19H28N2O7 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[5-(3,4-dihydro-2H-pyran-2-ylmethoxy)pentylamino]-4-oxobutanoate |
| SMILES | O=C(CCC(=O)ON1C(=O)CCC1=O)NCCCCCOCC1CCC=CO1 |
| InChI | InChI=1S/C19H28N2O7/c22-16(7-10-19(25)28-21-17(23)8-9-18(21)24)20-11-3-1-4-12-26-14-15-6-2-5-13-27-15/h5,13,15H,1-4,6-12,14H2,(H,20,22) |
| InChIKey | QTEGDPMPYJBHEE-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|