C11H21NO3Si — CID 11276581
tert-butyl N-(3-trimethylsilylprop-2-ynoxy)carbamate (PubChem CID 11276581) has the molecular formula C11H21NO3Si and a molecular weight of 243.38 g/mol. Its IUPAC name is tert-butyl N-(3-trimethylsilylprop-2-ynoxy)carbamate.
| Compound Name | tert-butyl N-(3-trimethylsilylprop-2-ynoxy)carbamate |
|---|---|
| PubChem CID | 11276581 |
| Molecular Formula | C11H21NO3Si |
| Molecular Weight | 243.38 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | tert-butyl N-(3-trimethylsilylprop-2-ynoxy)carbamate |
| SMILES | CC(C)(C)OC(=O)NOCC#C[Si](C)(C)C |
| InChI | InChI=1S/C11H21NO3Si/c1-11(2,3)15-10(13)12-14-8-7-9-16(4,5)6/h8H2,1-6H3,(H,12,13) |
| InChIKey | XQEGKZZUZQESCF-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|