C18H17ClN2O3S2 — CID 112797382
3-(1,3-benzothiazol-2-yl)-N-[(5-chlorothiophen-2-yl)methyl]-2,3-dihydroxy-N-prop-2-enylpropanamide (PubChem CID 112797382) has the molecular formula C18H17ClN2O3S2 and a molecular weight of 408.93 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-yl)-N-[(5-chlorothiophen-2-yl)methyl]-2,3-dihydroxy-N-prop-2-enylpropanamide.
| Compound Name | 3-(1,3-benzothiazol-2-yl)-N-[(5-chlorothiophen-2-yl)methyl]-2,3-dihydroxy-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 112797382 |
| Molecular Formula | C18H17ClN2O3S2 |
| Molecular Weight | 408.93 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | 3-(1,3-benzothiazol-2-yl)-N-[(5-chlorothiophen-2-yl)methyl]-2,3-dihydroxy-N-prop-2-enylpropanamide |
| SMILES | C=CCN(Cc1ccc(Cl)s1)C(=O)C(O)C(O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C18H17ClN2O3S2/c1-2-9-21(10-11-7-8-14(19)25-11)18(24)16(23)15(22)17-20-12-5-3-4-6-13(12)26-17/h2-8,15-16,22-23H,1,9-10H2 |
| InChIKey | KOJNWSUMRGNYSL-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.93 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|