C11H16N3O3+ — CID 11299361
(Z)-2-[(5R,6R,8R,8aR)-6,8-dimethyl-3-oxo-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-5-yl]-2-hydroxyethenediazonium (PubChem CID 11299361) has the molecular formula C11H16N3O3+ and a molecular weight of 238.27 g/mol. Its IUPAC name is (Z)-2-[(5R,6R,8R,8aR)-6,8-dimethyl-3-oxo-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-5-yl]-2-hydroxyethenediazonium.
| Compound Name | (Z)-2-[(5R,6R,8R,8aR)-6,8-dimethyl-3-oxo-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-5-yl]-2-hydroxyethenediazonium |
|---|---|
| PubChem CID | 11299361 |
| Molecular Formula | C11H16N3O3+ |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | (Z)-2-[(5R,6R,8R,8aR)-6,8-dimethyl-3-oxo-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-5-yl]-2-hydroxyethenediazonium |
| SMILES | C[C@@H]1C[C@@H](C)[C@H](/C(O)=C/[N+]#N)N2C(=O)OC[C@@H]12 |
| InChI | InChI=1S/C11H15N3O3/c1-6-3-7(2)10(9(15)4-13-12)14-8(6)5-17-11(14)16/h4,6-8,10H,3,5H2,1-2H3/p+1/b9-4-/t6-,7-,8+,10-/m1/s1 |
| InChIKey | JRJQEGUOOXERGS-HPBZUFBTSA-O |
| XLogP | 2.10 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|