C20H34O5Si — CID 11315077
(1aR,2R,7aR,7bS)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,6-dimethyl-7b-prop-2-enyl-1a,2,4,7a-tetrahydrooxireno[2,3-h][1,3]benzodioxin-2-ol (PubChem CID 11315077) has the molecular formula C20H34O5Si and a molecular weight of 382.57 g/mol. Its IUPAC name is (1aR,2R,7aR,7bS)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,6-dimethyl-7b-prop-2-enyl-1a,2,4,7a-tetrahydrooxireno[2,3-h][1,3]benzodioxin-2-ol.
| Compound Name | (1aR,2R,7aR,7bS)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,6-dimethyl-7b-prop-2-enyl-1a,2,4,7a-tetrahydrooxireno[2,3-h][1,3]benzodioxin-2-ol |
|---|---|
| PubChem CID | 11315077 |
| Molecular Formula | C20H34O5Si |
| Molecular Weight | 382.57 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | (1aR,2R,7aR,7bS)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-6,6-dimethyl-7b-prop-2-enyl-1a,2,4,7a-tetrahydrooxireno[2,3-h][1,3]benzodioxin-2-ol |
| SMILES | C=CC[C@@]12O[C@@H]1[C@H](O)C(CO[Si](C)(C)C(C)(C)C)=C1COC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C20H34O5Si/c1-9-10-20-16-14(11-22-19(5,6)24-16)13(15(21)17(20)25-20)12-23-26(7,8)18(2,3)4/h9,15-17,21H,1,10-12H2,2-8H3/t15-,16-,17-,20+/m1/s1 |
| InChIKey | YLTSQLGUCVTUIT-VIPLHTEESA-N |
| XLogP | 3.54 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.57 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|