C29H42O6Si — CID 11329742
6-[6-[tert-butyl(dimethyl)silyl]oxy-1-(4-methoxyphenyl)-3-oxohexan-2-yl]-2,4-dimethoxy-3-methylbenzaldehyde (PubChem CID 11329742) has the molecular formula C29H42O6Si and a molecular weight of 514.74 g/mol. Its IUPAC name is 6-[6-[tert-butyl(dimethyl)silyl]oxy-1-(4-methoxyphenyl)-3-oxohexan-2-yl]-2,4-dimethoxy-3-methylbenzaldehyde.
| Compound Name | 6-[6-[tert-butyl(dimethyl)silyl]oxy-1-(4-methoxyphenyl)-3-oxohexan-2-yl]-2,4-dimethoxy-3-methylbenzaldehyde |
|---|---|
| PubChem CID | 11329742 |
| Molecular Formula | C29H42O6Si |
| Molecular Weight | 514.74 g/mol |
| Exact Mass | 514.28 |
| IUPAC Name | 6-[6-[tert-butyl(dimethyl)silyl]oxy-1-(4-methoxyphenyl)-3-oxohexan-2-yl]-2,4-dimethoxy-3-methylbenzaldehyde |
| SMILES | COc1ccc(CC(C(=O)CCCO[Si](C)(C)C(C)(C)C)c2cc(OC)c(C)c(OC)c2C=O)cc1 |
| InChI | InChI=1S/C29H42O6Si/c1-20-27(33-6)18-23(25(19-30)28(20)34-7)24(17-21-12-14-22(32-5)15-13-21)26(31)11-10-16-35-36(8,9)29(2,3)4/h12-15,18-19,24H,10-11,16-17H2,1-9H3 |
| InChIKey | OQKZWGWFIRQUEE-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.74 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|