About 3-methylbut-3-enyl 3-phenylpropan(18O)oate
3-methylbut-3-enyl 3-phenylpropan(18O)oate (PubChem CID 11345035) has the molecular formula C14H18O2
and a molecular weight of 220.30 g/mol. Its IUPAC name is 3-methylbut-3-enyl 3-phenylpropan(18O)oate.
Molecular Properties
| Compound Name | 3-methylbut-3-enyl 3-phenylpropan(18O)oate |
| PubChem CID | 11345035 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 3-methylbut-3-enyl 3-phenylpropan(18O)oate |
| SMILES | C=C(C)CC[18O]C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C14H18O2/c1-12(2)10-11-16-14(15)9-8-13-6-4-3-5-7-13/h3-7H,1,8-11H2,2H3/i16+2 |
| InChIKey | NIZWABMMSYPSNU-VPMSBSONSA-N |
| XLogP | 3.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbut-3-enyl 3-phenylpropan(18O)oate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbut-3-enyl 3-phenylpropan(18O)oate?
The IUPAC name of 3-methylbut-3-enyl 3-phenylpropan(18O)oate (CID 11345035) is 3-methylbut-3-enyl 3-phenylpropan(18O)oate.
What is the SMILES notation for 3-methylbut-3-enyl 3-phenylpropan(18O)oate?
The canonical SMILES for 3-methylbut-3-enyl 3-phenylpropan(18O)oate is C=C(C)CC[18O]C(=O)CCc1ccccc1.
What is the InChIKey of 3-methylbut-3-enyl 3-phenylpropan(18O)oate?
The InChIKey is NIZWABMMSYPSNU-VPMSBSONSA-N. The full InChI is InChI=1S/C14H18O2/c1-12(2)10-11-16-14(15)9-8-13-6-4-3-5-7-13/h3-7H,1,8-11H2,2H3/i16+2.
What are the key properties of 3-methylbut-3-enyl 3-phenylpropan(18O)oate?
3-methylbut-3-enyl 3-phenylpropan(18O)oate has a molecular weight of 220.30 g/mol, XLogP of 3.13, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbut-3-enyl 3-phenylpropan(18O)oate is sourced from PubChem (CID 11345035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).