C28H26O2 — CID 11374343
CID 11374343 (PubChem CID 11374343) has the molecular formula C28H26O2 and a molecular weight of 394.51 g/mol.
| Compound Name | CID 11374343 |
|---|---|
| PubChem CID | 11374343 |
| Molecular Formula | C28H26O2 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | — |
| SMILES | O[C@H]([C]1[CH][CH][CH][CH]1)[C@H]1[C@@H](c2ccccc2)[C@@H](c2ccccc2)C[C@]1(O)[C]1[CH][CH][CH][CH]1 |
| InChI | InChI=1S/C28H26O2/c29-27(22-15-7-8-16-22)26-25(21-13-5-2-6-14-21)24(20-11-3-1-4-12-20)19-28(26,30)23-17-9-10-18-23/h1-18,24-27,29-30H,19H2/t24-,25+,26-,27-,28+/m1/s1 |
| InChIKey | ZGRHJMRGSYCZSQ-QLHPUIKHSA-N |
| XLogP | 4.48 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |