C25H48N2O5Si3 — CID 11376152
(2R,3S,4R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,8,8-trimethyl-5-oxa-1,12-diaza-8-silatricyclo[7.4.0.02,6]tridec-9-ene-11,13-dione (PubChem CID 11376152) has the molecular formula C25H48N2O5Si3 and a molecular weight of 540.93 g/mol. Its IUPAC name is (2R,3S,4R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,8,8-trimethyl-5-oxa-1,12-diaza-8-silatricyclo[7.4.0.02,6]tridec-9-ene-11,13-dione.
| Compound Name | (2R,3S,4R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,8,8-trimethyl-5-oxa-1,12-diaza-8-silatricyclo[7.4.0.02,6]tridec-9-ene-11,13-dione |
|---|---|
| PubChem CID | 11376152 |
| Molecular Formula | C25H48N2O5Si3 |
| Molecular Weight | 540.93 g/mol |
| Exact Mass | 540.29 |
| IUPAC Name | (2R,3S,4R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,8,8-trimethyl-5-oxa-1,12-diaza-8-silatricyclo[7.4.0.02,6]tridec-9-ene-11,13-dione |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H]2C[Si](C)(C)c3cc(=O)[nH]c(=O)n3[C@@]2(C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H48N2O5Si3/c1-23(2,3)34(10,11)30-15-17-21(32-35(12,13)24(4,5)6)25(7)18(31-17)16-33(8,9)20-14-19(28)26-22(29)27(20)25/h14,17-18,21H,15-16H2,1-13H3,(H,26,28,29)/t17-,18+,21-,25-/m1/s1 |
| InChIKey | QLLAJAMLTCOWBG-ONFALJKLSA-N |
| XLogP | 4.36 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.93 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|