C15H16O4S2 — CID 11393172
[(2S,4R,5R)-4-(benzenesulfonyl)-5-thiophen-2-yloxolan-2-yl]methanol (PubChem CID 11393172) has the molecular formula C15H16O4S2 and a molecular weight of 324.42 g/mol. Its IUPAC name is [(2S,4R,5R)-4-(benzenesulfonyl)-5-thiophen-2-yloxolan-2-yl]methanol.
| Compound Name | [(2S,4R,5R)-4-(benzenesulfonyl)-5-thiophen-2-yloxolan-2-yl]methanol |
|---|---|
| PubChem CID | 11393172 |
| Molecular Formula | C15H16O4S2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | [(2S,4R,5R)-4-(benzenesulfonyl)-5-thiophen-2-yloxolan-2-yl]methanol |
| SMILES | O=S(=O)(c1ccccc1)[C@@H]1C[C@@H](CO)O[C@H]1c1cccs1 |
| InChI | InChI=1S/C15H16O4S2/c16-10-11-9-14(15(19-11)13-7-4-8-20-13)21(17,18)12-5-2-1-3-6-12/h1-8,11,14-16H,9-10H2/t11-,14+,15-/m0/s1 |
| InChIKey | UVEQBWINOFLBCD-GLQYFDAESA-N |
| XLogP | 2.41 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |