C31H43BrO4Si — CID 11399141
(E,7R)-2-[(1R,2S)-4-bromo-1-(methoxymethoxy)-2-methylbut-3-ynyl]-7-[tert-butyl(diphenyl)silyl]oxyoct-2-en-1-ol (PubChem CID 11399141) has the molecular formula C31H43BrO4Si and a molecular weight of 587.67 g/mol. Its IUPAC name is (E,7R)-2-[(1R,2S)-4-bromo-1-(methoxymethoxy)-2-methylbut-3-ynyl]-7-[tert-butyl(diphenyl)silyl]oxyoct-2-en-1-ol.
| Compound Name | (E,7R)-2-[(1R,2S)-4-bromo-1-(methoxymethoxy)-2-methylbut-3-ynyl]-7-[tert-butyl(diphenyl)silyl]oxyoct-2-en-1-ol |
|---|---|
| PubChem CID | 11399141 |
| Molecular Formula | C31H43BrO4Si |
| Molecular Weight | 587.67 g/mol |
| Exact Mass | 586.21 |
| IUPAC Name | (E,7R)-2-[(1R,2S)-4-bromo-1-(methoxymethoxy)-2-methylbut-3-ynyl]-7-[tert-butyl(diphenyl)silyl]oxyoct-2-en-1-ol |
| SMILES | COCO[C@@H](/C(=C/CCC[C@@H](C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)CO)[C@@H](C)C#CBr |
| InChI | InChI=1S/C31H43BrO4Si/c1-25(21-22-32)30(35-24-34-6)27(23-33)16-14-13-15-26(2)36-37(31(3,4)5,28-17-9-7-10-18-28)29-19-11-8-12-20-29/h7-12,16-20,25-26,30,33H,13-15,23-24H2,1-6H3/b27-16+/t25-,26+,30+/m0/s1 |
| InChIKey | FXSRXEIEKASUCQ-LSIUZJSVSA-N |
| XLogP | 6.02 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.67 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|