C23H24F2O6S — CID 11408693
(1'S,4S,4'S,5'R,6'S)-5'-(benzenesulfonyl)-3',3'-difluoro-2,2-dimethyl-6'-phenylmethoxyspiro[1,3-dioxolane-4,2'-7-oxabicyclo[2.2.1]heptane] (PubChem CID 11408693) has the molecular formula C23H24F2O6S and a molecular weight of 466.50 g/mol. Its IUPAC name is (1'S,4S,4'S,5'R,6'S)-5'-(benzenesulfonyl)-3',3'-difluoro-2,2-dimethyl-6'-phenylmethoxyspiro[1,3-dioxolane-4,2'-7-oxabicyclo[2.2.1]heptane].
| Compound Name | (1'S,4S,4'S,5'R,6'S)-5'-(benzenesulfonyl)-3',3'-difluoro-2,2-dimethyl-6'-phenylmethoxyspiro[1,3-dioxolane-4,2'-7-oxabicyclo[2.2.1]heptane] |
|---|---|
| PubChem CID | 11408693 |
| Molecular Formula | C23H24F2O6S |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | (1'S,4S,4'S,5'R,6'S)-5'-(benzenesulfonyl)-3',3'-difluoro-2,2-dimethyl-6'-phenylmethoxyspiro[1,3-dioxolane-4,2'-7-oxabicyclo[2.2.1]heptane] |
| SMILES | CC1(C)OC[C@]2(O1)[C@H]1O[C@H]([C@H](S(=O)(=O)c3ccccc3)[C@H]1OCc1ccccc1)C2(F)F |
| InChI | InChI=1S/C23H24F2O6S/c1-21(2)29-14-22(31-21)19-17(28-13-15-9-5-3-6-10-15)18(20(30-19)23(22,24)25)32(26,27)16-11-7-4-8-12-16/h3-12,17-20H,13-14H2,1-2H3/t17-,18-,19+,20-,22+/m1/s1 |
| InChIKey | PHFCXHUJMQKBFG-JPVHLGFFSA-N |
| XLogP | 3.35 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |