C15H25F2N — CID 114216002
1-(cyclohepten-1-yl)-1-(3,3-difluorocyclohexyl)-N-methylmethanamine (PubChem CID 114216002) has the molecular formula C15H25F2N and a molecular weight of 257.37 g/mol. Its IUPAC name is 1-(cyclohepten-1-yl)-1-(3,3-difluorocyclohexyl)-N-methylmethanamine.
| Compound Name | 1-(cyclohepten-1-yl)-1-(3,3-difluorocyclohexyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 114216002 |
| Molecular Formula | C15H25F2N |
| Molecular Weight | 257.37 g/mol |
| Exact Mass | 257.20 |
| IUPAC Name | 1-(cyclohepten-1-yl)-1-(3,3-difluorocyclohexyl)-N-methylmethanamine |
| SMILES | CNC(C1=CCCCCC1)C1CCCC(F)(F)C1 |
| InChI | InChI=1S/C15H25F2N/c1-18-14(12-7-4-2-3-5-8-12)13-9-6-10-15(16,17)11-13/h7,13-14,18H,2-6,8-11H2,1H3 |
| InChIKey | VBDUIKVNXDZZIH-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.37 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|